C4H6BrN3S — CID 163359565
3-bromo-4-ethyl-1H-1,2,4-triazole-5-thione (PubChem CID 163359565) has the molecular formula C4H6BrN3S and a molecular weight of 208.08 g/mol. Its IUPAC name is 3-bromo-4-ethyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-bromo-4-ethyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 163359565 |
| Molecular Formula | C4H6BrN3S |
| Molecular Weight | 208.08 g/mol |
| Exact Mass | 206.95 |
| IUPAC Name | 3-bromo-4-ethyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCn1c(Br)n[nH]c1=S |
| InChI | InChI=1S/C4H6BrN3S/c1-2-8-3(5)6-7-4(8)9/h2H2,1H3,(H,7,9) |
| InChIKey | SEUYAGKHHXCUBR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.08 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|