C9H16N4OS — CID 43645553
4-ethyl-3-(3-methylmorpholin-4-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 43645553) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is 4-ethyl-3-(3-methylmorpholin-4-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-ethyl-3-(3-methylmorpholin-4-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 43645553 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-ethyl-3-(3-methylmorpholin-4-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCn1c(N2CCOCC2C)n[nH]c1=S |
| InChI | InChI=1S/C9H16N4OS/c1-3-12-8(10-11-9(12)15)13-4-5-14-6-7(13)2/h7H,3-6H2,1-2H3,(H,11,15) |
| InChIKey | UHSVWUJHHPEZIG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 46.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|