C11H21N5S — CID 114538847
4-ethyl-3-(3,4,5-trimethylpiperazin-1-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 114538847) has the molecular formula C11H21N5S and a molecular weight of 255.39 g/mol. Its IUPAC name is 4-ethyl-3-(3,4,5-trimethylpiperazin-1-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-ethyl-3-(3,4,5-trimethylpiperazin-1-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 114538847 |
| Molecular Formula | C11H21N5S |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 4-ethyl-3-(3,4,5-trimethylpiperazin-1-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCn1c(N2CC(C)N(C)C(C)C2)n[nH]c1=S |
| InChI | InChI=1S/C11H21N5S/c1-5-16-10(12-13-11(16)17)15-6-8(2)14(4)9(3)7-15/h8-9H,5-7H2,1-4H3,(H,13,17) |
| InChIKey | VVRGRMXVWZJWOI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 40.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|