C7H9F4N3O — CID 115396743
[4-ethyl-5-(1,1,2,2-tetrafluoroethyl)-1,2,4-triazol-3-yl]methanol (PubChem CID 115396743) has the molecular formula C7H9F4N3O and a molecular weight of 227.16 g/mol. Its IUPAC name is [4-ethyl-5-(1,1,2,2-tetrafluoroethyl)-1,2,4-triazol-3-yl]methanol.
| Compound Name | [4-ethyl-5-(1,1,2,2-tetrafluoroethyl)-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 115396743 |
| Molecular Formula | C7H9F4N3O |
| Molecular Weight | 227.16 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | [4-ethyl-5-(1,1,2,2-tetrafluoroethyl)-1,2,4-triazol-3-yl]methanol |
| SMILES | CCn1c(CO)nnc1C(F)(F)C(F)F |
| InChI | InChI=1S/C7H9F4N3O/c1-2-14-4(3-15)12-13-6(14)7(10,11)5(8)9/h5,15H,2-3H2,1H3 |
| InChIKey | KZQVKSCNTWSHRE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.16 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|