C9H12F5N3O — CID 115396445
[4-tert-butyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-3-yl]methanol (PubChem CID 115396445) has the molecular formula C9H12F5N3O and a molecular weight of 273.21 g/mol. Its IUPAC name is [4-tert-butyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-3-yl]methanol.
| Compound Name | [4-tert-butyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 115396445 |
| Molecular Formula | C9H12F5N3O |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | [4-tert-butyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-3-yl]methanol |
| SMILES | CC(C)(C)n1c(CO)nnc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H12F5N3O/c1-7(2,3)17-5(4-18)15-16-6(17)8(10,11)9(12,13)14/h18H,4H2,1-3H3 |
| InChIKey | FHKWFPYOEHUZJS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|