C8H12F3N3S — CID 115390887
4-(2-methylpropyl)-3-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 115390887) has the molecular formula C8H12F3N3S and a molecular weight of 239.27 g/mol. Its IUPAC name is 4-(2-methylpropyl)-3-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2-methylpropyl)-3-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 115390887 |
| Molecular Formula | C8H12F3N3S |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 4-(2-methylpropyl)-3-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)Cn1c(CC(F)(F)F)n[nH]c1=S |
| InChI | InChI=1S/C8H12F3N3S/c1-5(2)4-14-6(3-8(9,10)11)12-13-7(14)15/h5H,3-4H2,1-2H3,(H,13,15) |
| InChIKey | KNBULXVYSFLHSF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|