C11H21N3S — CID 115390826
4-(2-methylpropyl)-3-pentan-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 115390826) has the molecular formula C11H21N3S and a molecular weight of 227.38 g/mol. Its IUPAC name is 4-(2-methylpropyl)-3-pentan-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2-methylpropyl)-3-pentan-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 115390826 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 4-(2-methylpropyl)-3-pentan-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCC(C)c1n[nH]c(=S)n1CC(C)C |
| InChI | InChI=1S/C11H21N3S/c1-5-6-9(4)10-12-13-11(15)14(10)7-8(2)3/h8-9H,5-7H2,1-4H3,(H,13,15) |
| InChIKey | SPHVVKCAKPKFJM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|