C10H12N4S — CID 13402338
4-anilino-3-ethyl-1H-1,2,4-triazole-5-thione (PubChem CID 13402338) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 4-anilino-3-ethyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-anilino-3-ethyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 13402338 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 4-anilino-3-ethyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1n[nH]c(=S)n1Nc1ccccc1 |
| InChI | InChI=1S/C10H12N4S/c1-2-9-11-12-10(15)14(9)13-8-6-4-3-5-7-8/h3-7,13H,2H2,1H3,(H,12,15) |
| InChIKey | KDYCMFQERYJMLC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|