C7H11N7S — CID 80686439
3-amino-4-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 80686439) has the molecular formula C7H11N7S and a molecular weight of 225.28 g/mol. Its IUPAC name is 3-amino-4-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-amino-4-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 80686439 |
| Molecular Formula | C7H11N7S |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 3-amino-4-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cn1cnc(CCn2c(N)n[nH]c2=S)n1 |
| InChI | InChI=1S/C7H11N7S/c1-13-4-9-5(12-13)2-3-14-6(8)10-11-7(14)15/h4H,2-3H2,1H3,(H2,8,10)(H,11,15) |
| InChIKey | BQIHLXDBJKTDOJ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|