C11H10ClN5O — CID 106406239
6-chloro-1-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine (PubChem CID 106406239) has the molecular formula C11H10ClN5O and a molecular weight of 263.69 g/mol. Its IUPAC name is 6-chloro-1-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine.
| Compound Name | 6-chloro-1-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 106406239 |
| Molecular Formula | C11H10ClN5O |
| Molecular Weight | 263.69 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 6-chloro-1-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzimidazol-2-amine |
| SMILES | Nc1nc2ccc(Cl)cc2n1CCc1ncon1 |
| InChI | InChI=1S/C11H10ClN5O/c12-7-1-2-8-9(5-7)17(11(13)15-8)4-3-10-14-6-18-16-10/h1-2,5-6H,3-4H2,(H2,13,15) |
| InChIKey | UYORBYVNVUBLPO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.69 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |