C12H9Cl2N3S — CID 115470651
6-chloro-1-[(5-chlorothiophen-2-yl)methyl]benzimidazol-2-amine (PubChem CID 115470651) has the molecular formula C12H9Cl2N3S and a molecular weight of 298.20 g/mol. Its IUPAC name is 6-chloro-1-[(5-chlorothiophen-2-yl)methyl]benzimidazol-2-amine.
| Compound Name | 6-chloro-1-[(5-chlorothiophen-2-yl)methyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 115470651 |
| Molecular Formula | C12H9Cl2N3S |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 6-chloro-1-[(5-chlorothiophen-2-yl)methyl]benzimidazol-2-amine |
| SMILES | Nc1nc2ccc(Cl)cc2n1Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H9Cl2N3S/c13-7-1-3-9-10(5-7)17(12(15)16-9)6-8-2-4-11(14)18-8/h1-5H,6H2,(H2,15,16) |
| InChIKey | NXJLRJVXYHELKV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |