C12H11ClN4S — CID 113316213
6-chloro-1-[2-(1,3-thiazol-4-yl)ethyl]benzimidazol-2-amine (PubChem CID 113316213) has the molecular formula C12H11ClN4S and a molecular weight of 278.77 g/mol. Its IUPAC name is 6-chloro-1-[2-(1,3-thiazol-4-yl)ethyl]benzimidazol-2-amine.
| Compound Name | 6-chloro-1-[2-(1,3-thiazol-4-yl)ethyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 113316213 |
| Molecular Formula | C12H11ClN4S |
| Molecular Weight | 278.77 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 6-chloro-1-[2-(1,3-thiazol-4-yl)ethyl]benzimidazol-2-amine |
| SMILES | Nc1nc2ccc(Cl)cc2n1CCc1cscn1 |
| InChI | InChI=1S/C12H11ClN4S/c13-8-1-2-10-11(5-8)17(12(14)16-10)4-3-9-6-18-7-15-9/h1-2,5-7H,3-4H2,(H2,14,16) |
| InChIKey | LWQUYIQWFSPFFF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.77 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |