C13H19ClN4 — CID 115470600
6-chloro-1-[2-[methyl(propan-2-yl)amino]ethyl]benzimidazol-2-amine (PubChem CID 115470600) has the molecular formula C13H19ClN4 and a molecular weight of 266.78 g/mol. Its IUPAC name is 6-chloro-1-[2-[methyl(propan-2-yl)amino]ethyl]benzimidazol-2-amine.
| Compound Name | 6-chloro-1-[2-[methyl(propan-2-yl)amino]ethyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 115470600 |
| Molecular Formula | C13H19ClN4 |
| Molecular Weight | 266.78 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 6-chloro-1-[2-[methyl(propan-2-yl)amino]ethyl]benzimidazol-2-amine |
| SMILES | CC(C)N(C)CCn1c(N)nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C13H19ClN4/c1-9(2)17(3)6-7-18-12-8-10(14)4-5-11(12)16-13(18)15/h4-5,8-9H,6-7H2,1-3H3,(H2,15,16) |
| InChIKey | PRQXEJZEDAVBGT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.78 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |