C11H14ClN3O2S — CID 114101010
6-chloro-3-(2,3-dimethoxypropyl)-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 114101010) has the molecular formula C11H14ClN3O2S and a molecular weight of 287.77 g/mol. Its IUPAC name is 6-chloro-3-(2,3-dimethoxypropyl)-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 6-chloro-3-(2,3-dimethoxypropyl)-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 114101010 |
| Molecular Formula | C11H14ClN3O2S |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 6-chloro-3-(2,3-dimethoxypropyl)-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | COCC(Cn1c(=S)[nH]c2cc(Cl)cnc21)OC |
| InChI | InChI=1S/C11H14ClN3O2S/c1-16-6-8(17-2)5-15-10-9(14-11(15)18)3-7(12)4-13-10/h3-4,8H,5-6H2,1-2H3,(H,14,18) |
| InChIKey | ZPJQBHJXMKMKNR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|