C14H11F2N3S — CID 62532205
4,5-difluoro-3-[(6-methyl-2-pyridinyl)methyl]-1H-benzimidazole-2-thione (PubChem CID 62532205) has the molecular formula C14H11F2N3S and a molecular weight of 291.33 g/mol. Its IUPAC name is 4,5-difluoro-3-[(6-methyl-2-pyridinyl)methyl]-1H-benzimidazole-2-thione.
| Compound Name | 4,5-difluoro-3-[(6-methyl-2-pyridinyl)methyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 62532205 |
| Molecular Formula | C14H11F2N3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 4,5-difluoro-3-[(6-methyl-2-pyridinyl)methyl]-1H-benzimidazole-2-thione |
| SMILES | Cc1cccc(Cn2c(=S)[nH]c3ccc(F)c(F)c32)n1 |
| InChI | InChI=1S/C14H11F2N3S/c1-8-3-2-4-9(17-8)7-19-13-11(18-14(19)20)6-5-10(15)12(13)16/h2-6H,7H2,1H3,(H,18,20) |
| InChIKey | IHLVAJSEBRRCEW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|