C12H14FIN2O2S — CID 66099774
5-fluoro-6-iodo-3-[2-(2-methoxyethoxy)ethyl]-1H-benzimidazole-2-thione (PubChem CID 66099774) has the molecular formula C12H14FIN2O2S and a molecular weight of 396.23 g/mol. Its IUPAC name is 5-fluoro-6-iodo-3-[2-(2-methoxyethoxy)ethyl]-1H-benzimidazole-2-thione.
| Compound Name | 5-fluoro-6-iodo-3-[2-(2-methoxyethoxy)ethyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66099774 |
| Molecular Formula | C12H14FIN2O2S |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | 5-fluoro-6-iodo-3-[2-(2-methoxyethoxy)ethyl]-1H-benzimidazole-2-thione |
| SMILES | COCCOCCn1c(=S)[nH]c2cc(I)c(F)cc21 |
| InChI | InChI=1S/C12H14FIN2O2S/c1-17-4-5-18-3-2-16-11-6-8(13)9(14)7-10(11)15-12(16)19/h6-7H,2-5H2,1H3,(H,15,19) |
| InChIKey | BJDNCXOLYBVORL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|