C15H19FIN3S — CID 107164598
3-[(1,4-dimethylpiperidin-4-yl)methyl]-5-fluoro-6-iodo-1H-benzimidazole-2-thione (PubChem CID 107164598) has the molecular formula C15H19FIN3S and a molecular weight of 419.31 g/mol. Its IUPAC name is 3-[(1,4-dimethylpiperidin-4-yl)methyl]-5-fluoro-6-iodo-1H-benzimidazole-2-thione.
| Compound Name | 3-[(1,4-dimethylpiperidin-4-yl)methyl]-5-fluoro-6-iodo-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 107164598 |
| Molecular Formula | C15H19FIN3S |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | 3-[(1,4-dimethylpiperidin-4-yl)methyl]-5-fluoro-6-iodo-1H-benzimidazole-2-thione |
| SMILES | CN1CCC(C)(Cn2c(=S)[nH]c3cc(I)c(F)cc32)CC1 |
| InChI | InChI=1S/C15H19FIN3S/c1-15(3-5-19(2)6-4-15)9-20-13-7-10(16)11(17)8-12(13)18-14(20)21/h7-8H,3-6,9H2,1-2H3,(H,18,21) |
| InChIKey | OIYVVNSPDRYMFZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 23.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|