C12H14FIN4OS — CID 83114856
3-[2-(6-fluoro-5-iodo-2-sulfanylidene-3H-benzimidazol-1-yl)ethyl]-1,1-dimethylurea (PubChem CID 83114856) has the molecular formula C12H14FIN4OS and a molecular weight of 408.24 g/mol. Its IUPAC name is 3-[2-(6-fluoro-5-iodo-2-sulfanylidene-3H-benzimidazol-1-yl)ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-(6-fluoro-5-iodo-2-sulfanylidene-3H-benzimidazol-1-yl)ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83114856 |
| Molecular Formula | C12H14FIN4OS |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | 3-[2-(6-fluoro-5-iodo-2-sulfanylidene-3H-benzimidazol-1-yl)ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCn1c(=S)[nH]c2cc(I)c(F)cc21 |
| InChI | InChI=1S/C12H14FIN4OS/c1-17(2)11(19)15-3-4-18-10-5-7(13)8(14)6-9(10)16-12(18)20/h5-6H,3-4H2,1-2H3,(H,15,19)(H,16,20) |
| InChIKey | FRBIKJAANLZXSE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 53.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|