C12H8BrFN2S2 — CID 66087630
6-bromo-5-fluoro-3-(thiophen-2-ylmethyl)-1H-benzimidazole-2-thione (PubChem CID 66087630) has the molecular formula C12H8BrFN2S2 and a molecular weight of 343.25 g/mol. Its IUPAC name is 6-bromo-5-fluoro-3-(thiophen-2-ylmethyl)-1H-benzimidazole-2-thione.
| Compound Name | 6-bromo-5-fluoro-3-(thiophen-2-ylmethyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66087630 |
| Molecular Formula | C12H8BrFN2S2 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 341.93 |
| IUPAC Name | 6-bromo-5-fluoro-3-(thiophen-2-ylmethyl)-1H-benzimidazole-2-thione |
| SMILES | Fc1cc2c(cc1Br)[nH]c(=S)n2Cc1cccs1 |
| InChI | InChI=1S/C12H8BrFN2S2/c13-8-4-10-11(5-9(8)14)16(12(17)15-10)6-7-2-1-3-18-7/h1-5H,6H2,(H,15,17) |
| InChIKey | ZFJNSQYDSGQFFI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|