C12H9BrFN3S2 — CID 66088409
6-bromo-5-fluoro-3-[(4-methyl-1,3-thiazol-2-yl)methyl]-1H-benzimidazole-2-thione (PubChem CID 66088409) has the molecular formula C12H9BrFN3S2 and a molecular weight of 358.26 g/mol. Its IUPAC name is 6-bromo-5-fluoro-3-[(4-methyl-1,3-thiazol-2-yl)methyl]-1H-benzimidazole-2-thione.
| Compound Name | 6-bromo-5-fluoro-3-[(4-methyl-1,3-thiazol-2-yl)methyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66088409 |
| Molecular Formula | C12H9BrFN3S2 |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 356.94 |
| IUPAC Name | 6-bromo-5-fluoro-3-[(4-methyl-1,3-thiazol-2-yl)methyl]-1H-benzimidazole-2-thione |
| SMILES | Cc1csc(Cn2c(=S)[nH]c3cc(Br)c(F)cc32)n1 |
| InChI | InChI=1S/C12H9BrFN3S2/c1-6-5-19-11(15-6)4-17-10-3-8(14)7(13)2-9(10)16-12(17)18/h2-3,5H,4H2,1H3,(H,16,18) |
| InChIKey | SUFNPROYDZMUPL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|