C11H10F2N2O2S — CID 115508213
methyl 3-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)propanoate (PubChem CID 115508213) has the molecular formula C11H10F2N2O2S and a molecular weight of 272.28 g/mol. Its IUPAC name is methyl 3-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)propanoate.
| Compound Name | methyl 3-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)propanoate |
|---|---|
| PubChem CID | 115508213 |
| Molecular Formula | C11H10F2N2O2S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | methyl 3-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)propanoate |
| SMILES | COC(=O)CCn1c(=S)[nH]c2c(F)cc(F)cc21 |
| InChI | InChI=1S/C11H10F2N2O2S/c1-17-9(16)2-3-15-8-5-6(12)4-7(13)10(8)14-11(15)18/h4-5H,2-3H2,1H3,(H,14,18) |
| InChIKey | ACWIECKZJYQHCN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|