C12H15FN2S2 — CID 113477786
7-fluoro-3-(4-methylsulfanylbutan-2-yl)-1H-benzimidazole-2-thione (PubChem CID 113477786) has the molecular formula C12H15FN2S2 and a molecular weight of 270.40 g/mol. Its IUPAC name is 7-fluoro-3-(4-methylsulfanylbutan-2-yl)-1H-benzimidazole-2-thione.
| Compound Name | 7-fluoro-3-(4-methylsulfanylbutan-2-yl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 113477786 |
| Molecular Formula | C12H15FN2S2 |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 7-fluoro-3-(4-methylsulfanylbutan-2-yl)-1H-benzimidazole-2-thione |
| SMILES | CSCCC(C)n1c(=S)[nH]c2c(F)cccc21 |
| InChI | InChI=1S/C12H15FN2S2/c1-8(6-7-17-2)15-10-5-3-4-9(13)11(10)14-12(15)16/h3-5,8H,6-7H2,1-2H3,(H,14,16) |
| InChIKey | WUULYZFLRCOEEL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|