C7H9N5S2 — CID 64571546
3-amino-4-[1-(1,3-thiazol-2-yl)ethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 64571546) has the molecular formula C7H9N5S2 and a molecular weight of 227.32 g/mol. Its IUPAC name is 3-amino-4-[1-(1,3-thiazol-2-yl)ethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-amino-4-[1-(1,3-thiazol-2-yl)ethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 64571546 |
| Molecular Formula | C7H9N5S2 |
| Molecular Weight | 227.32 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 3-amino-4-[1-(1,3-thiazol-2-yl)ethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CC(c1nccs1)n1c(N)n[nH]c1=S |
| InChI | InChI=1S/C7H9N5S2/c1-4(5-9-2-3-14-5)12-6(8)10-11-7(12)13/h2-4H,1H3,(H2,8,10)(H,11,13) |
| InChIKey | QIMKLZHMBZXMLJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|