C9H11N3O2S — CID 64955458
1-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione (PubChem CID 64955458) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is 1-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione.
| Compound Name | 1-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 64955458 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 1-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione |
| SMILES | CC(c1nccs1)N1CC(=O)NCC1=O |
| InChI | InChI=1S/C9H11N3O2S/c1-6(9-10-2-3-15-9)12-5-7(13)11-4-8(12)14/h2-3,6H,4-5H2,1H3,(H,11,13) |
| InChIKey | CSQNSXOQNPSWRQ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |