About 2-[1-(3,3-diethylpiperazin-1-yl)ethyl]-1,3-thiazole
2-[1-(3,3-diethylpiperazin-1-yl)ethyl]-1,3-thiazole (PubChem CID 64953645) has the molecular formula C13H23N3S
and a molecular weight of 253.41 g/mol. Its IUPAC name is 2-[1-(3,3-diethylpiperazin-1-yl)ethyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[1-(3,3-diethylpiperazin-1-yl)ethyl]-1,3-thiazole |
| PubChem CID | 64953645 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-[1-(3,3-diethylpiperazin-1-yl)ethyl]-1,3-thiazole |
| SMILES | CCC1(CC)CN(C(C)c2nccs2)CCN1 |
| InChI | InChI=1S/C13H23N3S/c1-4-13(5-2)10-16(8-6-15-13)11(3)12-14-7-9-17-12/h7,9,11,15H,4-6,8,10H2,1-3H3 |
| InChIKey | ZWBTZFPVOPFQCB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-(3,3-diethylpiperazin-1-yl)ethyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3,3-diethylpiperazin-1-yl)ethyl]-1,3-thiazole?
The IUPAC name of 2-[1-(3,3-diethylpiperazin-1-yl)ethyl]-1,3-thiazole (CID 64953645) is 2-[1-(3,3-diethylpiperazin-1-yl)ethyl]-1,3-thiazole.
What is the SMILES notation for 2-[1-(3,3-diethylpiperazin-1-yl)ethyl]-1,3-thiazole?
The canonical SMILES for 2-[1-(3,3-diethylpiperazin-1-yl)ethyl]-1,3-thiazole is CCC1(CC)CN(C(C)c2nccs2)CCN1.
What is the InChIKey of 2-[1-(3,3-diethylpiperazin-1-yl)ethyl]-1,3-thiazole?
The InChIKey is ZWBTZFPVOPFQCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3S/c1-4-13(5-2)10-16(8-6-15-13)11(3)12-14-7-9-17-12/h7,9,11,15H,4-6,8,10H2,1-3H3.
What are the key properties of 2-[1-(3,3-diethylpiperazin-1-yl)ethyl]-1,3-thiazole?
2-[1-(3,3-diethylpiperazin-1-yl)ethyl]-1,3-thiazole has a molecular weight of 253.41 g/mol, XLogP of 2.67, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3,3-diethylpiperazin-1-yl)ethyl]-1,3-thiazole is sourced from PubChem (CID 64953645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).