4-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2-carboxylic acid

C10H15N3O2S — CID 71633476

IUPAC4-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2-carboxylic acid
SMILESCC(c1nccs1)N1CCNC(C(=O)O)C1
InChIInChI=1S/C10H15N3O2S/c1-7(9-12-3-5-16-9)13-4-2-11-8(6-13)10(14)15/h3,5,7-8,11H,2,4,6H2,1H3,(H,14,15)
InChIKeyVJOJGQJLRCUZCS-UHFFFAOYSA-N
MW241.32 g/mol
LogP0.56
Rot. Bonds3

About 4-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2-carboxylic acid

4-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2-carboxylic acid (PubChem CID 71633476) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is 4-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2-carboxylic acid.

Molecular Properties

Compound Name4-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2-carboxylic acid
PubChem CID71633476
Molecular FormulaC10H15N3O2S
Molecular Weight241.32 g/mol
Exact Mass241.09
IUPAC Name4-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2-carboxylic acid
SMILESCC(c1nccs1)N1CCNC(C(=O)O)C1
InChIInChI=1S/C10H15N3O2S/c1-7(9-12-3-5-16-9)13-4-2-11-8(6-13)10(14)15/h3,5,7-8,11H,2,4,6H2,1H3,(H,14,15)
InChIKeyVJOJGQJLRCUZCS-UHFFFAOYSA-N
XLogP0.56
TPSA65.46 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.32
LogP ≤ 50.56
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 4-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2-carboxylic acid?
The IUPAC name of 4-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2-carboxylic acid (CID 71633476) is 4-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2-carboxylic acid.
What is the SMILES notation for 4-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2-carboxylic acid?
The canonical SMILES for 4-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2-carboxylic acid is CC(c1nccs1)N1CCNC(C(=O)O)C1.
What is the InChIKey of 4-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2-carboxylic acid?
The InChIKey is VJOJGQJLRCUZCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2S/c1-7(9-12-3-5-16-9)13-4-2-11-8(6-13)10(14)15/h3,5,7-8,11H,2,4,6H2,1H3,(H,14,15).
What are the key properties of 4-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2-carboxylic acid?
4-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2-carboxylic acid has a molecular weight of 241.32 g/mol, XLogP of 0.56, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2-carboxylic acid is sourced from PubChem (CID 71633476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).