About [(3S)-1-[(1R)-1-(1,3-thiazol-2-yl)ethyl]piperidin-3-yl]methanol
[(3S)-1-[(1R)-1-(1,3-thiazol-2-yl)ethyl]piperidin-3-yl]methanol (PubChem CID 86324532) has the molecular formula C11H18N2OS
and a molecular weight of 226.34 g/mol. Its IUPAC name is [(3S)-1-[(1R)-1-(1,3-thiazol-2-yl)ethyl]piperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S)-1-[(1R)-1-(1,3-thiazol-2-yl)ethyl]piperidin-3-yl]methanol |
| PubChem CID | 86324532 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | [(3S)-1-[(1R)-1-(1,3-thiazol-2-yl)ethyl]piperidin-3-yl]methanol |
| SMILES | C[C@H](c1nccs1)N1CCC[C@H](CO)C1 |
| InChI | InChI=1S/C11H18N2OS/c1-9(11-12-4-6-15-11)13-5-2-3-10(7-13)8-14/h4,6,9-10,14H,2-3,5,7-8H2,1H3/t9-,10+/m1/s1 |
| InChIKey | VLGMOLAFUBVKKH-ZJUUUORDSA-N |
| XLogP | 1.91 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3S)-1-[(1R)-1-(1,3-thiazol-2-yl)ethyl]piperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-1-[(1R)-1-(1,3-thiazol-2-yl)ethyl]piperidin-3-yl]methanol?
The IUPAC name of [(3S)-1-[(1R)-1-(1,3-thiazol-2-yl)ethyl]piperidin-3-yl]methanol (CID 86324532) is [(3S)-1-[(1R)-1-(1,3-thiazol-2-yl)ethyl]piperidin-3-yl]methanol.
What is the SMILES notation for [(3S)-1-[(1R)-1-(1,3-thiazol-2-yl)ethyl]piperidin-3-yl]methanol?
The canonical SMILES for [(3S)-1-[(1R)-1-(1,3-thiazol-2-yl)ethyl]piperidin-3-yl]methanol is C[C@H](c1nccs1)N1CCC[C@H](CO)C1.
What is the InChIKey of [(3S)-1-[(1R)-1-(1,3-thiazol-2-yl)ethyl]piperidin-3-yl]methanol?
The InChIKey is VLGMOLAFUBVKKH-ZJUUUORDSA-N. The full InChI is InChI=1S/C11H18N2OS/c1-9(11-12-4-6-15-11)13-5-2-3-10(7-13)8-14/h4,6,9-10,14H,2-3,5,7-8H2,1H3/t9-,10+/m1/s1.
What are the key properties of [(3S)-1-[(1R)-1-(1,3-thiazol-2-yl)ethyl]piperidin-3-yl]methanol?
[(3S)-1-[(1R)-1-(1,3-thiazol-2-yl)ethyl]piperidin-3-yl]methanol has a molecular weight of 226.34 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-1-[(1R)-1-(1,3-thiazol-2-yl)ethyl]piperidin-3-yl]methanol is sourced from PubChem (CID 86324532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).