C12H19NOS — CID 98084280
[(3R)-1-[(1S)-1-thiophen-2-ylethyl]piperidin-3-yl]methanol (PubChem CID 98084280) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is [(3R)-1-[(1S)-1-thiophen-2-ylethyl]piperidin-3-yl]methanol.
| Compound Name | [(3R)-1-[(1S)-1-thiophen-2-ylethyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 98084280 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | [(3R)-1-[(1S)-1-thiophen-2-ylethyl]piperidin-3-yl]methanol |
| SMILES | C[C@@H](c1cccs1)N1CCC[C@@H](CO)C1 |
| InChI | InChI=1S/C12H19NOS/c1-10(12-5-3-7-15-12)13-6-2-4-11(8-13)9-14/h3,5,7,10-11,14H,2,4,6,8-9H2,1H3/t10-,11+/m0/s1 |
| InChIKey | SVUOSTNVDSJTFU-WDEREUQCSA-N |
| XLogP | 2.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |