C10H18N2O2 — CID 64955992
1-hexan-3-ylpiperazine-2,5-dione (PubChem CID 64955992) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 1-hexan-3-ylpiperazine-2,5-dione.
| Compound Name | 1-hexan-3-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64955992 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-hexan-3-ylpiperazine-2,5-dione |
| SMILES | CCCC(CC)N1CC(=O)NCC1=O |
| InChI | InChI=1S/C10H18N2O2/c1-3-5-8(4-2)12-7-9(13)11-6-10(12)14/h8H,3-7H2,1-2H3,(H,11,13) |
| InChIKey | KPMLZKZNZUXHAR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |