C9H19N3O — CID 145049642
4-hexan-3-yl-1,2,4-triazinan-3-one (PubChem CID 145049642) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is 4-hexan-3-yl-1,2,4-triazinan-3-one.
| Compound Name | 4-hexan-3-yl-1,2,4-triazinan-3-one |
|---|---|
| PubChem CID | 145049642 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 4-hexan-3-yl-1,2,4-triazinan-3-one |
| SMILES | CCCC(CC)N1CCNNC1=O |
| InChI | InChI=1S/C9H19N3O/c1-3-5-8(4-2)12-7-6-10-11-9(12)13/h8,10H,3-7H2,1-2H3,(H,11,13) |
| InChIKey | DHLRWNGWFLMLCT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |