C6H13N3O — CID 141022388
4-butan-2-yl-1,2,4-triazolidin-3-one (PubChem CID 141022388) has the molecular formula C6H13N3O and a molecular weight of 143.19 g/mol. Its IUPAC name is 4-butan-2-yl-1,2,4-triazolidin-3-one.
| Compound Name | 4-butan-2-yl-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 141022388 |
| Molecular Formula | C6H13N3O |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | 4-butan-2-yl-1,2,4-triazolidin-3-one |
| SMILES | CCC(C)N1CNNC1=O |
| InChI | InChI=1S/C6H13N3O/c1-3-5(2)9-4-7-8-6(9)10/h5,7H,3-4H2,1-2H3,(H,8,10) |
| InChIKey | DXCADWLLUHWWCS-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |