About 1-butan-2-yl-1,4-diazocan-2-one
1-butan-2-yl-1,4-diazocan-2-one (PubChem CID 117016136) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-butan-2-yl-1,4-diazocan-2-one.
Molecular Properties
| Compound Name | 1-butan-2-yl-1,4-diazocan-2-one |
| PubChem CID | 117016136 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 1-butan-2-yl-1,4-diazocan-2-one |
| SMILES | CCC(C)N1CCCCNCC1=O |
| InChI | InChI=1S/C10H20N2O/c1-3-9(2)12-7-5-4-6-11-8-10(12)13/h9,11H,3-8H2,1-2H3 |
| InChIKey | QXVWJRHOGZKCIA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butan-2-yl-1,4-diazocan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-1,4-diazocan-2-one?
The IUPAC name of 1-butan-2-yl-1,4-diazocan-2-one (CID 117016136) is 1-butan-2-yl-1,4-diazocan-2-one.
What is the SMILES notation for 1-butan-2-yl-1,4-diazocan-2-one?
The canonical SMILES for 1-butan-2-yl-1,4-diazocan-2-one is CCC(C)N1CCCCNCC1=O.
What is the InChIKey of 1-butan-2-yl-1,4-diazocan-2-one?
The InChIKey is QXVWJRHOGZKCIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-3-9(2)12-7-5-4-6-11-8-10(12)13/h9,11H,3-8H2,1-2H3.
What are the key properties of 1-butan-2-yl-1,4-diazocan-2-one?
1-butan-2-yl-1,4-diazocan-2-one has a molecular weight of 184.28 g/mol, XLogP of 1.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-1,4-diazocan-2-one is sourced from PubChem (CID 117016136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).