C14H21N3O2S — CID 64972721
3,3-diethyl-1-[1-(1,3-thiazol-2-yl)propyl]piperazine-2,5-dione (PubChem CID 64972721) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 3,3-diethyl-1-[1-(1,3-thiazol-2-yl)propyl]piperazine-2,5-dione.
| Compound Name | 3,3-diethyl-1-[1-(1,3-thiazol-2-yl)propyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 64972721 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 3,3-diethyl-1-[1-(1,3-thiazol-2-yl)propyl]piperazine-2,5-dione |
| SMILES | CCC(c1nccs1)N1CC(=O)NC(CC)(CC)C1=O |
| InChI | InChI=1S/C14H21N3O2S/c1-4-10(12-15-7-8-20-12)17-9-11(18)16-14(5-2,6-3)13(17)19/h7-8,10H,4-6,9H2,1-3H3,(H,16,18) |
| InChIKey | HCBPMQLTNMHOEK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |