C13H14N4S — CID 113333995
7-methyl-1-[1-(1,3-thiazol-2-yl)ethyl]benzimidazol-2-amine (PubChem CID 113333995) has the molecular formula C13H14N4S and a molecular weight of 258.35 g/mol. Its IUPAC name is 7-methyl-1-[1-(1,3-thiazol-2-yl)ethyl]benzimidazol-2-amine.
| Compound Name | 7-methyl-1-[1-(1,3-thiazol-2-yl)ethyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 113333995 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 7-methyl-1-[1-(1,3-thiazol-2-yl)ethyl]benzimidazol-2-amine |
| SMILES | Cc1cccc2nc(N)n(C(C)c3nccs3)c12 |
| InChI | InChI=1S/C13H14N4S/c1-8-4-3-5-10-11(8)17(13(14)16-10)9(2)12-15-6-7-18-12/h3-7,9H,1-2H3,(H2,14,16) |
| InChIKey | IYMRGODNWBQVMF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |