C14H16ClFN2S — CID 107419570
6-chloro-5-fluoro-3-[(2-methylcyclopentyl)methyl]-1H-benzimidazole-2-thione (PubChem CID 107419570) has the molecular formula C14H16ClFN2S and a molecular weight of 298.81 g/mol. Its IUPAC name is 6-chloro-5-fluoro-3-[(2-methylcyclopentyl)methyl]-1H-benzimidazole-2-thione.
| Compound Name | 6-chloro-5-fluoro-3-[(2-methylcyclopentyl)methyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 107419570 |
| Molecular Formula | C14H16ClFN2S |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 6-chloro-5-fluoro-3-[(2-methylcyclopentyl)methyl]-1H-benzimidazole-2-thione |
| SMILES | CC1CCCC1Cn1c(=S)[nH]c2cc(Cl)c(F)cc21 |
| InChI | InChI=1S/C14H16ClFN2S/c1-8-3-2-4-9(8)7-18-13-6-11(16)10(15)5-12(13)17-14(18)19/h5-6,8-9H,2-4,7H2,1H3,(H,17,19) |
| InChIKey | ARTABIPAEFXQCR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|