C11H10ClFN2S — CID 66078664
6-chloro-3-cyclobutyl-5-fluoro-1H-benzimidazole-2-thione (PubChem CID 66078664) has the molecular formula C11H10ClFN2S and a molecular weight of 256.73 g/mol. Its IUPAC name is 6-chloro-3-cyclobutyl-5-fluoro-1H-benzimidazole-2-thione.
| Compound Name | 6-chloro-3-cyclobutyl-5-fluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66078664 |
| Molecular Formula | C11H10ClFN2S |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 6-chloro-3-cyclobutyl-5-fluoro-1H-benzimidazole-2-thione |
| SMILES | Fc1cc2c(cc1Cl)[nH]c(=S)n2C1CCC1 |
| InChI | InChI=1S/C11H10ClFN2S/c12-7-4-9-10(5-8(7)13)15(11(16)14-9)6-2-1-3-6/h4-6H,1-3H2,(H,14,16) |
| InChIKey | CGNUPAWHPOLTIA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|