C14H17ClFN3OS — CID 114400750
6-chloro-3-[(4-ethylmorpholin-2-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione (PubChem CID 114400750) has the molecular formula C14H17ClFN3OS and a molecular weight of 329.83 g/mol. Its IUPAC name is 6-chloro-3-[(4-ethylmorpholin-2-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione.
| Compound Name | 6-chloro-3-[(4-ethylmorpholin-2-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 114400750 |
| Molecular Formula | C14H17ClFN3OS |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 6-chloro-3-[(4-ethylmorpholin-2-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione |
| SMILES | CCN1CCOC(Cn2c(=S)[nH]c3cc(Cl)c(F)cc32)C1 |
| InChI | InChI=1S/C14H17ClFN3OS/c1-2-18-3-4-20-9(7-18)8-19-13-6-11(16)10(15)5-12(13)17-14(19)21/h5-6,9H,2-4,7-8H2,1H3,(H,17,21) |
| InChIKey | AQGYPWRJASVRRD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 33.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|