C11H11N3S2 — CID 106431456
1-(2-prop-2-ynylsulfanylethyl)-3H-imidazo[4,5-c]pyridine-2-thione (PubChem CID 106431456) has the molecular formula C11H11N3S2 and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-(2-prop-2-ynylsulfanylethyl)-3H-imidazo[4,5-c]pyridine-2-thione.
| Compound Name | 1-(2-prop-2-ynylsulfanylethyl)-3H-imidazo[4,5-c]pyridine-2-thione |
|---|---|
| PubChem CID | 106431456 |
| Molecular Formula | C11H11N3S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 1-(2-prop-2-ynylsulfanylethyl)-3H-imidazo[4,5-c]pyridine-2-thione |
| SMILES | C#CCSCCn1c(=S)[nH]c2cnccc21 |
| InChI | InChI=1S/C11H11N3S2/c1-2-6-16-7-5-14-10-3-4-12-8-9(10)13-11(14)15/h1,3-4,8H,5-7H2,(H,13,15) |
| InChIKey | YTNPACQOYDIJEH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|