C13H19N3S2 — CID 114139507
4-tert-butyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1H-imidazole-2-thione (PubChem CID 114139507) has the molecular formula C13H19N3S2 and a molecular weight of 281.45 g/mol. Its IUPAC name is 4-tert-butyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1H-imidazole-2-thione.
| Compound Name | 4-tert-butyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 114139507 |
| Molecular Formula | C13H19N3S2 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 4-tert-butyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1H-imidazole-2-thione |
| SMILES | Cc1nc(CCn2c(C(C)(C)C)c[nH]c2=S)cs1 |
| InChI | InChI=1S/C13H19N3S2/c1-9-15-10(8-18-9)5-6-16-11(13(2,3)4)7-14-12(16)17/h7-8H,5-6H2,1-4H3,(H,14,17) |
| InChIKey | HTEDNHQASJOTFJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|