C12H17N3S2 — CID 81335659
4-tert-butyl-3-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-imidazole-2-thione (PubChem CID 81335659) has the molecular formula C12H17N3S2 and a molecular weight of 267.42 g/mol. Its IUPAC name is 4-tert-butyl-3-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-imidazole-2-thione.
| Compound Name | 4-tert-butyl-3-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 81335659 |
| Molecular Formula | C12H17N3S2 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 4-tert-butyl-3-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-imidazole-2-thione |
| SMILES | Cc1nc(Cn2c(C(C)(C)C)c[nH]c2=S)cs1 |
| InChI | InChI=1S/C12H17N3S2/c1-8-14-9(7-17-8)6-15-10(12(2,3)4)5-13-11(15)16/h5,7H,6H2,1-4H3,(H,13,16) |
| InChIKey | HYKDHNVHKHGEGH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|