C8H9N3O2S — CID 103601183
3-[(2-methyl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4-dione (PubChem CID 103601183) has the molecular formula C8H9N3O2S and a molecular weight of 211.25 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 3-[(2-methyl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 103601183 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 3-[(2-methyl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1nc(CN2C(=O)CNC2=O)cs1 |
| InChI | InChI=1S/C8H9N3O2S/c1-5-10-6(4-14-5)3-11-7(12)2-9-8(11)13/h4H,2-3H2,1H3,(H,9,13) |
| InChIKey | HQUGLBAZZNWKFJ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|