About 2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridazin-3-one
2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridazin-3-one (PubChem CID 141198028) has the molecular formula C9H9N3OS
and a molecular weight of 207.26 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridazin-3-one.
Analyze 2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridazin-3-one?
The IUPAC name of 2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridazin-3-one (CID 141198028) is 2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridazin-3-one.
What is the SMILES notation for 2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridazin-3-one?
The canonical SMILES for 2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridazin-3-one is Cc1nc(Cn2ncccc2=O)cs1.
What is the InChIKey of 2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridazin-3-one?
The InChIKey is XBDNNXLGECMEIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3OS/c1-7-11-8(6-14-7)5-12-9(13)3-2-4-10-12/h2-4,6H,5H2,1H3.
What are the key properties of 2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridazin-3-one?
2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridazin-3-one has a molecular weight of 207.26 g/mol, XLogP of 1.06, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridazin-3-one is sourced from PubChem (CID 141198028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).