C13H11N3O2S — CID 55177822
1-[(2-methyl-1,3-thiazol-4-yl)methyl]indazole-3-carboxylic acid (PubChem CID 55177822) has the molecular formula C13H11N3O2S and a molecular weight of 273.32 g/mol. Its IUPAC name is 1-[(2-methyl-1,3-thiazol-4-yl)methyl]indazole-3-carboxylic acid.
| Compound Name | 1-[(2-methyl-1,3-thiazol-4-yl)methyl]indazole-3-carboxylic acid |
|---|---|
| PubChem CID | 55177822 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 1-[(2-methyl-1,3-thiazol-4-yl)methyl]indazole-3-carboxylic acid |
| SMILES | Cc1nc(Cn2nc(C(=O)O)c3ccccc32)cs1 |
| InChI | InChI=1S/C13H11N3O2S/c1-8-14-9(7-19-8)6-16-11-5-3-2-4-10(11)12(15-16)13(17)18/h2-5,7H,6H2,1H3,(H,17,18) |
| InChIKey | JPHJJROOQSXAPF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |