C15H17N3S — CID 141439042
4-[(3-methylindazol-1-yl)methyl]-2-propan-2-yl-1,3-thiazole (PubChem CID 141439042) has the molecular formula C15H17N3S and a molecular weight of 271.39 g/mol. Its IUPAC name is 4-[(3-methylindazol-1-yl)methyl]-2-propan-2-yl-1,3-thiazole.
| Compound Name | 4-[(3-methylindazol-1-yl)methyl]-2-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 141439042 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 4-[(3-methylindazol-1-yl)methyl]-2-propan-2-yl-1,3-thiazole |
| SMILES | Cc1nn(Cc2csc(C(C)C)n2)c2ccccc12 |
| InChI | InChI=1S/C15H17N3S/c1-10(2)15-16-12(9-19-15)8-18-14-7-5-4-6-13(14)11(3)17-18/h4-7,9-10H,8H2,1-3H3 |
| InChIKey | GJUKQFVVHSMNDP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |