C12H15N3S — CID 115589690
N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]pyridin-2-amine (PubChem CID 115589690) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]pyridin-2-amine.
| Compound Name | N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 115589690 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]pyridin-2-amine |
| SMILES | CC(C)c1nc(CNc2ccccn2)cs1 |
| InChI | InChI=1S/C12H15N3S/c1-9(2)12-15-10(8-16-12)7-14-11-5-3-4-6-13-11/h3-6,8-9H,7H2,1-2H3,(H,13,14) |
| InChIKey | MHNOWSJYWYLQRK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |