C22H24N2OS — CID 56522612
N-(1,1-diphenylethyl)-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 56522612) has the molecular formula C22H24N2OS and a molecular weight of 364.51 g/mol. Its IUPAC name is N-(1,1-diphenylethyl)-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(1,1-diphenylethyl)-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 56522612 |
| Molecular Formula | C22H24N2OS |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-(1,1-diphenylethyl)-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | CC(C)c1nc(CC(=O)NC(C)(c2ccccc2)c2ccccc2)cs1 |
| InChI | InChI=1S/C22H24N2OS/c1-16(2)21-23-19(15-26-21)14-20(25)24-22(3,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,15-16H,14H2,1-3H3,(H,24,25) |
| InChIKey | ZUTNANNMPJOCIH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |