C18H23N3O3S — CID 39716291
N'-[2-(2,6-dimethylphenoxy)acetyl]-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetohydrazide (PubChem CID 39716291) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is N'-[2-(2,6-dimethylphenoxy)acetyl]-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetohydrazide.
| Compound Name | N'-[2-(2,6-dimethylphenoxy)acetyl]-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetohydrazide |
|---|---|
| PubChem CID | 39716291 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N'-[2-(2,6-dimethylphenoxy)acetyl]-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetohydrazide |
| SMILES | Cc1cccc(C)c1OCC(=O)NNC(=O)Cc1csc(C(C)C)n1 |
| InChI | InChI=1S/C18H23N3O3S/c1-11(2)18-19-14(10-25-18)8-15(22)20-21-16(23)9-24-17-12(3)6-5-7-13(17)4/h5-7,10-11H,8-9H2,1-4H3,(H,20,22)(H,21,23) |
| InChIKey | CQWREWVZBNQCCO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|