C15H13N3O2S — CID 103119513
1-(1-methylindazol-3-yl)-3-(2-methyl-1,3-thiazol-4-yl)propane-1,3-dione (PubChem CID 103119513) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is 1-(1-methylindazol-3-yl)-3-(2-methyl-1,3-thiazol-4-yl)propane-1,3-dione.
| Compound Name | 1-(1-methylindazol-3-yl)-3-(2-methyl-1,3-thiazol-4-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 103119513 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 1-(1-methylindazol-3-yl)-3-(2-methyl-1,3-thiazol-4-yl)propane-1,3-dione |
| SMILES | Cc1nc(C(=O)CC(=O)c2nn(C)c3ccccc23)cs1 |
| InChI | InChI=1S/C15H13N3O2S/c1-9-16-11(8-21-9)13(19)7-14(20)15-10-5-3-4-6-12(10)18(2)17-15/h3-6,8H,7H2,1-2H3 |
| InChIKey | ULMHTLRJSBVLCA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|