C14H12N4O2S — CID 103118181
N-(4-acetyl-1,3-thiazol-2-yl)-1-methylindazole-3-carboxamide (PubChem CID 103118181) has the molecular formula C14H12N4O2S and a molecular weight of 300.34 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)-1-methylindazole-3-carboxamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)-1-methylindazole-3-carboxamide |
|---|---|
| PubChem CID | 103118181 |
| Molecular Formula | C14H12N4O2S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)-1-methylindazole-3-carboxamide |
| SMILES | CC(=O)c1csc(NC(=O)c2nn(C)c3ccccc23)n1 |
| InChI | InChI=1S/C14H12N4O2S/c1-8(19)10-7-21-14(15-10)16-13(20)12-9-5-3-4-6-11(9)18(2)17-12/h3-7H,1-2H3,(H,15,16,20) |
| InChIKey | CVQZSTGJBCJMPB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |