C15H11N3O3S — CID 51262518
N-(4-acetyl-1,3-thiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 51262518) has the molecular formula C15H11N3O3S and a molecular weight of 313.34 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 51262518 |
| Molecular Formula | C15H11N3O3S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | CC(=O)c1csc(NC(=O)c2cc(-c3ccccc3)on2)n1 |
| InChI | InChI=1S/C15H11N3O3S/c1-9(19)12-8-22-15(16-12)17-14(20)11-7-13(21-18-11)10-5-3-2-4-6-10/h2-8H,1H3,(H,16,17,20) |
| InChIKey | AJAOVKKOSNHULT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |